Difference between revisions of "CHC T00009204001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] == * smiles: ** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O) * inchi key...") |
(Created page with "Category:Gene == Gene CHC_T00009204001 == * left end position: ** 218404 * transcription direction: ** POSITIVE * right end position: ** 219897 * centisome position: ** 97...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009204001 == |
− | * | + | * left end position: |
− | ** | + | ** 218404 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 219897 |
− | * | + | * centisome position: |
− | ** | + | ** 97.00248 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=218404}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=219897}} | |
− | + | {{#set: centisome position=97.00248 }} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 17:55, 23 May 2018
Gene CHC_T00009204001
- left end position:
- 218404
- transcription direction:
- POSITIVE
- right end position:
- 219897
- centisome position:
- 97.00248
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome