Difference between revisions of "ALLO-THR"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] == * smiles: ** C([N+])C2(C1(C(=O)NC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLO-THR ALLO-THR] == * common name: ** DL-allothreonine * Synonym(s): ** allothreonine ** allo...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLO-THR ALLO-THR] ==
* smiles:
+
** C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))
+
* inchi key:
+
** InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** preQ1
+
** DL-allothreonine
* molecular weight:
+
** 180.189   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-aminomethyl-7-deazaguanine
+
** allothreonine
** 7-aminomethyl-7-carbaguanine
+
** allo-thr
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1321]]
+
* [[RXN0-5234]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=DL-allothreonine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202264 25202264]
+
{{#set: common name=allothreonine|allo-thr}}
* CHEBI:
+
{{#set: consumed by=RXN0-5234}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58703 58703]
+
{{#set: smiles=C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))}}
+
{{#set: inchi key=InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O}}
+
{{#set: common name=preQ1}}
+
{{#set: molecular weight=180.189    }}
+
{{#set: common name=7-aminomethyl-7-deazaguanine|7-aminomethyl-7-carbaguanine}}
+
{{#set: consumed by=RXN0-1321}}
+

Latest revision as of 16:56, 23 May 2018

Metabolite ALLO-THR

  • common name:
    • DL-allothreonine
  • Synonym(s):
    • allothreonine
    • allo-thr

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links