Difference between revisions of "L-1-LYSOPHOSPHATIDATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17789 RXN-17789] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L |
+ | * common name: | ||
+ | ** 1-oleyl-2-lyso-phosphatidate | ||
+ | * molecular weight: | ||
+ | ** 434.509 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-2-lysophosphatidate | ||
+ | ** lysophosphatidic acid | ||
+ | ** LPA | ||
+ | ** oleoyl lysophosphatidic acid | ||
+ | ** 1-oleoyl-lyso-phosphatidic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-15043]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15045]] | |
− | + | * [[RXN-15068]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173225 46173225] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74544 74544] |
− | {{#set: | + | * METABOLIGHTS : MTBLC74544 |
− | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L}} |
+ | {{#set: common name=1-oleyl-2-lyso-phosphatidate}} | ||
+ | {{#set: molecular weight=434.509 }} | ||
+ | {{#set: common name=L-2-lysophosphatidate|lysophosphatidic acid|LPA|oleoyl lysophosphatidic acid|1-oleoyl-lyso-phosphatidic acid}} | ||
+ | {{#set: consumed by=RXN-15043}} | ||
+ | {{#set: produced by=RXN-15045|RXN-15068}} |
Revision as of 16:57, 23 May 2018
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
- inchi key:
- InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L
- common name:
- 1-oleyl-2-lyso-phosphatidate
- molecular weight:
- 434.509
- Synonym(s):
- L-2-lysophosphatidate
- lysophosphatidic acid
- LPA
- oleoyl lysophosphatidic acid
- 1-oleoyl-lyso-phosphatidic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.