Difference between revisions of "RXN-8163"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] == * smiles: ** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8163 RXN-8163] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8163 RXN-8163] ==
−
* smiles:
+
* direction:
−
** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K
+
** [http://enzyme.expasy.org/EC/1.4.3.3 EC-1.4.3.3]
−
* common name:
+
−
** tetrahydromethanopterin
+
−
* molecular weight:
+
−
** 773.666   
+
 
* Synonym(s):
 
* Synonym(s):
−
** THMPT
 
−
** 5,6,7,8-tetrahydromethanopterin
 
−
** H4MPT
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-15635]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-219]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[2-KETO-6-AMINO-CAPROATE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 D-lysine[c] '''+''' 1 oxygen[c] '''=>''' 1 2-keto-6-aminocaproate[c] '''+''' 1 ammonium[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00003785001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00003782001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-5283]], L-lysine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5283 PWY-5283]
 +
** '''1''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791993 49791993]
+
{{#set: ec number=EC-1.4.3.3}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00003785001_1|CHC_T00003782001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58103 58103]
+
{{#set: in pathway=PWY-5283}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01217 C01217]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
* HMDB : HMDB60403
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)}}
+
−
{{#set: inchi key=InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K}}
+
−
{{#set: common name=tetrahydromethanopterin}}
+
−
{{#set: molecular weight=773.666    }}
+
−
{{#set: common name=THMPT|5,6,7,8-tetrahydromethanopterin|H4MPT}}
+
−
{{#set: produced by=RXN-15635}}
+

Latest revision as of 16:57, 23 May 2018

Reaction RXN-8163

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5283, L-lysine degradation V: PWY-5283
    • 1 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-8163&oldid=18658"