Difference between revisions of "RXN-8988"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8988 RXN-8988] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8988 RXN-8988] ==
* smiles:
+
* direction:
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N
+
** [http://enzyme.expasy.org/EC/6.2.1.4 EC-6.2.1.4]
* common name:
+
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
+
* molecular weight:
+
** 835.347   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol
 
** 6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9236]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CO-A]][c] '''+''' 1 [[ITACONATE]][c] '''+''' 1 [[GTP]][c] '''=>''' 1 [[CPD-1137]][c] '''+''' 1 [[GDP]][c] '''+''' 1 [[Pi]][c]
* [[RXN-9235]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 coenzyme A[c] '''+''' 1 itaconate[c] '''+''' 1 GTP[c] '''=>''' 1 itaconyl-CoA[c] '''+''' 1 GDP[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009212001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5749]], itaconate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5749 PWY-5749]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986092 50986092]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02405 R02405]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64181 64181]
+
{{#set: ec number=EC-6.2.1.4}}
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C}}
+
{{#set: gene associated=CHC_T00009212001_1}}
{{#set: inchi key=InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N}}
+
{{#set: in pathway=PWY-5749}}
{{#set: common name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=835.347    }}
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus}}
{{#set: common name=6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol|6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: consumed by=RXN-9236}}
+
{{#set: produced by=RXN-9235}}
+

Latest revision as of 17:58, 23 May 2018

Reaction RXN-8988

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 itaconate[c] + 1 GTP[c] => 1 itaconyl-CoA[c] + 1 GDP[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5749, itaconate degradation: PWY-5749
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links