Difference between revisions of "CPD-12936"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5282 RXN-5282] == * direction: ** LEFT-TO-RIGHT * common name: ** Magnesium-protoporphyrin IX m...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O |
+ | * inchi key: | ||
+ | ** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N | ||
* common name: | * common name: | ||
− | ** | + | ** apo-4'-lycopenal |
+ | * molecular weight: | ||
+ | ** 482.748 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11999]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183] |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}} |
− | + | {{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}} | |
− | + | {{#set: common name=apo-4'-lycopenal}} | |
− | {{#set: | + | {{#set: molecular weight=482.748 }} |
− | {{#set: | + | {{#set: produced by=RXN-11999}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:58, 23 May 2018
Contents
Metabolite CPD-12936
- smiles:
- CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
- inchi key:
- InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
- common name:
- apo-4'-lycopenal
- molecular weight:
- 482.748
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: