Difference between revisions of "Bromide"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Bromide Bromide] == * common name: ** an organobromine compound * Synonym(s): ** RBr == Reacti...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Bromide Bromide] ==
* smiles:
+
** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1)
+
* inchi key:
+
** InChIKey=WTFXTQVDAKGDEY-HTQZYQBOSA-L
+
 
* common name:
 
* common name:
** chorismate
+
** an organobromine compound
* molecular weight:
+
** 224.17   
+
 
* Synonym(s):
 
* Synonym(s):
** chorismic acid
+
** RBr
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CHORISMATE-SYNTHASE-RXN]]
+
* [[RXN-11329]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[CHORISMATEMUT-RXN]]
 
* [[PABASYN-RXN]]
 
* [[ANTHRANSYN-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 55508-12-8
+
{{#set: common name=an organobromine compound}}
* PUBCHEM:
+
{{#set: common name=RBr}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460312 5460312]
+
{{#set: produced by=RXN-11329}}
* HMDB : HMDB12199
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00251 C00251]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4573889.html 4573889]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29748 29748]
+
* BIGG : chor
+
{{#set: smiles=C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1)}}
+
{{#set: inchi key=InChIKey=WTFXTQVDAKGDEY-HTQZYQBOSA-L}}
+
{{#set: common name=chorismate}}
+
{{#set: molecular weight=224.17    }}
+
{{#set: common name=chorismic acid}}
+
{{#set: produced by=CHORISMATE-SYNTHASE-RXN}}
+
{{#set: consumed or produced by=CHORISMATEMUT-RXN|PABASYN-RXN|ANTHRANSYN-RXN}}
+

Latest revision as of 17:58, 23 May 2018

Metabolite Bromide

  • common name:
    • an organobromine compound
  • Synonym(s):
    • RBr

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links