Difference between revisions of "CPD-698"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1108 CPD-1108] == * common name: ** a 1-phosphatidyl-1D-myo-inositol 4-phosphate * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == |
| + | * smiles: | ||
| + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** campest-4-en-3-one |
| + | * molecular weight: | ||
| + | ** 398.671 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** methylcholestenone |
| − | ** | + | ** (24R)-24-methyl-cholest-4-en-3-one |
| + | ** 3-dehydro-Δ4-5-campesterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-4231]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11988279 11988279] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785] |
| + | * HMDB : HMDB12196 | ||
| + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}} | ||
| + | {{#set: common name=campest-4-en-3-one}} | ||
| + | {{#set: molecular weight=398.671 }} | ||
| + | {{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}} | ||
| + | {{#set: consumed by=RXN-4231}} | ||
Revision as of 16:59, 23 May 2018
Contents
Metabolite CPD-698
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
- common name:
- campest-4-en-3-one
- molecular weight:
- 398.671
- Synonym(s):
- methylcholestenone
- (24R)-24-methyl-cholest-4-en-3-one
- 3-dehydro-Δ4-5-campesterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
