Difference between revisions of "CHC T00009577001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene CHC_T00009577001 == * left end position: ** 296346 * transcription direction: ** NEGATIVE * right end position: ** 297476 * centisome position: ** 93...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009577001 == |
− | * | + | * left end position: |
− | ** | + | ** 296346 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 297476 |
− | * | + | * centisome position: |
− | ** | + | ** 93.20288 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CDPDIGLYSYN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN0-5515]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7817]] | ||
+ | * [[PWY-5667]] | ||
+ | * [[PWY0-1319]] | ||
+ | * [[PWY-5981]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=296346}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=297476}} | |
− | + | {{#set: centisome position=93.20288 }} | |
− | + | {{#set: reaction associated=CDPDIGLYSYN-RXN|RXN0-5515}} | |
− | + | {{#set: pathway associated=PWY-7817|PWY-5667|PWY0-1319|PWY-5981}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:59, 23 May 2018
Gene CHC_T00009577001
- left end position:
- 296346
- transcription direction:
- NEGATIVE
- right end position:
- 297476
- centisome position:
- 93.20288
- Synonym(s):
Reactions associated
- Reaction: CDPDIGLYSYN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN0-5515
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome