Difference between revisions of "CPD-9958"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHOCOAKIN-RXN DEPHOSPHOCOAKIN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://e...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9958 CPD-9958] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9958 CPD-9958] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QNTNKSLOFHEFPK-UPTCCGCDSA-N |
+ | * common name: | ||
+ | ** ubiquinol-10 | ||
+ | * molecular weight: | ||
+ | ** 865.373 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ubiquinol(10) | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9237]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9962735 9962735] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.8138335.html 8138335] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64183 64183] |
− | {{#set: | + | * METABOLIGHTS : MTBLC64183 |
− | {{#set: | + | * HMDB : HMDB13111 |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QNTNKSLOFHEFPK-UPTCCGCDSA-N}} |
− | {{#set: | + | {{#set: common name=ubiquinol-10}} |
+ | {{#set: molecular weight=865.373 }} | ||
+ | {{#set: common name=ubiquinol(10)}} | ||
+ | {{#set: produced by=RXN-9237}} |
Revision as of 16:59, 23 May 2018
Contents
Metabolite CPD-9958
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- inchi key:
- InChIKey=QNTNKSLOFHEFPK-UPTCCGCDSA-N
- common name:
- ubiquinol-10
- molecular weight:
- 865.373
- Synonym(s):
- ubiquinol(10)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links