Difference between revisions of "NIACINAMIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOX-RXN PEPCARBOX-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINAMIDE NIACINAMIDE] == * smiles: ** C1(N=CC(C(=O)N)=CC=1) * inchi key: ** InChIKey=DFPAKSU...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOX-RXN PEPCARBOX-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINAMIDE NIACINAMIDE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(N=CC(C(=O)N)=CC=1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/4.1.1.31 EC-4.1.1.31]
+
** InChIKey=DFPAKSUCGFBDDF-UHFFFAOYSA-N
 +
* common name:
 +
** nicotinamide
 +
* molecular weight:
 +
** 122.126   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-aminonicotinamide
 +
** vitamin PP
 +
** niacinamide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[NICOTINAMID-RXN]]
−
** 1 [[HCO3]][c] '''+''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[OXALACETIC_ACID]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 hydrogencarbonate[c] '''+''' 1 phosphoenolpyruvate[c] '''=>''' 1 phosphate[c] '''+''' 1 oxaloacetate[c]
+
* [[2.4.2.31-RXN]]
−
 
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008437001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
+
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-1622]], formaldehyde assimilation I (serine pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1622 PWY-1622]
+
−
** '''6''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PWYQT-4429]], CO2 fixation into oxaloacetate (anaplerotic): [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4429 PWYQT-4429]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-241]], C4 photosynthetic carbon assimilation cycle, NADP-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-241 PWY-241]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
+
−
** '''9''' reactions found over '''12''' reactions in the full pathway
+
−
* [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
+
−
** '''11''' reactions found over '''16''' reactions in the full pathway
+
−
* [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-6142]], gluconeogenesis II (Methanobacterium thermoautotrophicum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142]
+
−
** '''8''' reactions found over '''14''' reactions in the full pathway
+
−
* [[PWY-7124]], ethylene biosynthesis V (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7124 PWY-7124]
+
−
** '''8''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY-6146]], Methanobacterium thermoautotrophicum biosynthetic metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6146 PWY-6146]
+
−
** '''6''' reactions found over '''16''' reactions in the full pathway
+
−
* [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117]
+
−
** '''7''' reactions found over '''10''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CAS : 98-92-0
−
** [http://www.genome.jp/dbget-bin/www_bget?R00345 R00345]
+
* METABOLIGHTS : MTBLC17154
−
* UNIPROT:
+
* DRUGBANK : DB02701
−
** [http://www.uniprot.org/uniprot/P28594 P28594]
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P43920 P43920]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=936 936]
−
** [http://www.uniprot.org/uniprot/P29195 P29195]
+
* KNAPSACK : C00000209
−
** [http://www.uniprot.org/uniprot/P51059 P51059]
+
* HMDB : HMDB01406
−
** [http://www.uniprot.org/uniprot/P00864 P00864]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P12880 P12880]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00153 C00153]
−
** [http://www.uniprot.org/uniprot/P10490 P10490]
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/P16097 P16097]
+
** [http://www.chemspider.com/Chemical-Structure.911.html 911]
−
** [http://www.uniprot.org/uniprot/P27154 P27154]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P06516 P06516]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17154 17154]
−
** [http://www.uniprot.org/uniprot/Q43267 Q43267]
+
* BIGG : ncam
−
** [http://www.uniprot.org/uniprot/Q41197 Q41197]
+
{{#set: smiles=C1(N=CC(C(=O)N)=CC=1)}}
−
** [http://www.uniprot.org/uniprot/P29194 P29194]
+
{{#set: inchi key=InChIKey=DFPAKSUCGFBDDF-UHFFFAOYSA-N}}
−
** [http://www.uniprot.org/uniprot/P30694 P30694]
+
{{#set: common name=nicotinamide}}
−
** [http://www.uniprot.org/uniprot/P15804 P15804]
+
{{#set: molecular weight=122.126    }}
−
** [http://www.uniprot.org/uniprot/Q43268 Q43268]
+
{{#set: common name=6-aminonicotinamide|vitamin PP|niacinamide}}
−
** [http://www.uniprot.org/uniprot/Q01647 Q01647]
+
{{#set: consumed by=NICOTINAMID-RXN}}
−
** [http://www.uniprot.org/uniprot/Q01648 Q01648]
+
{{#set: reversible reaction associated=2.4.2.31-RXN|NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
−
** [http://www.uniprot.org/uniprot/Q02735 Q02735]
+
−
** [http://www.uniprot.org/uniprot/Q02909 Q02909]
+
−
** [http://www.uniprot.org/uniprot/Q42730 Q42730]
+
−
** [http://www.uniprot.org/uniprot/Q41198 Q41198]
+
−
** [http://www.uniprot.org/uniprot/P51063 P51063]
+
−
** [http://www.uniprot.org/uniprot/Q40103 Q40103]
+
−
** [http://www.uniprot.org/uniprot/Q40104 Q40104]
+
−
** [http://www.uniprot.org/uniprot/Q40105 Q40105]
+
−
** [http://www.uniprot.org/uniprot/Q40102 Q40102]
+
−
** [http://www.uniprot.org/uniprot/Q41836 Q41836]
+
−
** [http://www.uniprot.org/uniprot/O22118 O22118]
+
−
** [http://www.uniprot.org/uniprot/O22119 O22119]
+
−
** [http://www.uniprot.org/uniprot/O48623 O48623]
+
−
** [http://www.uniprot.org/uniprot/Q42634 Q42634]
+
−
** [http://www.uniprot.org/uniprot/O23946 O23946]
+
−
** [http://www.uniprot.org/uniprot/O23947 O23947]
+
−
** [http://www.uniprot.org/uniprot/Q84VW9 Q84VW9]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-4.1.1.31}}
+
−
{{#set: gene associated=CHC_T00008437001_1}}
+
−
{{#set: in pathway=PWY-5913|PWY-1622|PWYQT-4429|PWY-6549|PWY-241|P23-PWY|FERMENTATION-PWY|PWY-7115|PWY-6142|PWY-7124|PWY-6146|PWY-7117}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+

Revision as of 17:00, 23 May 2018

Metabolite NIACINAMIDE

  • smiles:
    • C1(N=CC(C(=O)N)=CC=1)
  • inchi key:
    • InChIKey=DFPAKSUCGFBDDF-UHFFFAOYSA-N
  • common name:
    • nicotinamide
  • molecular weight:
    • 122.126
  • Synonym(s):
    • 6-aminonicotinamide
    • vitamin PP
    • niacinamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 98-92-0
  • METABOLIGHTS : MTBLC17154
  • DRUGBANK : DB02701
  • PUBCHEM:
  • KNAPSACK : C00000209
  • HMDB : HMDB01406
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • BIGG : ncam




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=NIACINAMIDE&oldid=18809"