Difference between revisions of "CHC T00009386001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...")
 
(Created page with "Category:Gene == Gene CHC_T00009386001 == * left end position: ** 17314 * transcription direction: ** NEGATIVE * right end position: ** 17910 * centisome position: ** 5.05...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] ==
+
== Gene CHC_T00009386001 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
+
** 17314
−
* common name:
+
* transcription direction:
−
** Mg-protoporphyrin
+
** NEGATIVE
−
* molecular weight:
+
* right end position:
−
** 582.94    
+
** 17910
 +
* centisome position:
 +
** 5.052409    
 
* Synonym(s):
 
* Synonym(s):
−
** Mg-protoporphyrin IX
 
−
** magnesium protoporphyrin
 
−
** MgP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
* Reaction: [[GUANYL-KIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
* [[RXN1F-20]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7221]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=17314}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657481 90657481]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=17910}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60492 60492]
+
{{#set: centisome position=5.052409    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=GUANYL-KIN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03516 C03516]
+
{{#set: pathway associated=PWY-7221}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))}}
+
−
{{#set: common name=Mg-protoporphyrin}}
+
−
{{#set: molecular weight=582.94    }}
+
−
{{#set: common name=Mg-protoporphyrin IX|magnesium protoporphyrin|MgP}}
+
−
{{#set: consumed by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
+
−
{{#set: produced by=RXN1F-20}}
+

Latest revision as of 17:02, 23 May 2018

Gene CHC_T00009386001

  • left end position:
    • 17314
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 17910
  • centisome position:
    • 5.052409
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009386001&oldid=18887"