Difference between revisions of "RXN66-480"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == * smiles: ** CC(COP(=O)([O-])OP(=O)([O-])...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-480 RXN66-480] == * direction: ** LEFT-TO-RIGHT * common name: ** phytenoyl-CoA synthetase **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-480 RXN66-480] ==
−
* smiles:
+
* direction:
−
** CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J
+
 
* common name:
 
* common name:
−
** 3-hydroxyisovaleryl-CoA
+
** phytenoyl-CoA synthetase
−
* molecular weight:
+
** long-chain-fatty-acid-CoA ligase
−
** 863.619   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-isovaleryl-coa
 
−
** 3-hydroxy-iso-valeryl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-14927]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[CPD-14928]][c]
−
* [[RXN-14266]]
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 coenzyme A[c] '''+''' 1 phytenate[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 phytenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008811001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00009428001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00008160001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008500001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009428001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008811001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY66-389]], phytol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-389 PWY66-389]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203667 25203667]
+
{{#set: common name=phytenoyl-CoA synthetase}}
−
* CHEBI:
+
{{#set: common name=long-chain-fatty-acid-CoA ligase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62555 62555]
+
{{#set: ec number=EC-6.2.1.3}}
−
{{#set: smiles=CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O}}
+
{{#set: gene associated=CHC_T00008811001_1|CHC_T00009428001_1|CHC_T00008160001_1|CHC_T00008500001_1|CHC_T00009428001|CHC_T00008811001}}
−
{{#set: inchi key=InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J}}
+
{{#set: in pathway=PWY66-389}}
−
{{#set: common name=3-hydroxyisovaleryl-CoA}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=863.619    }}
+
{{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
−
{{#set: common name=3-hydroxy-isovaleryl-coa|3-hydroxy-iso-valeryl-CoA}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: consumed or produced by=RXN-14266}}
+

Revision as of 17:02, 23 May 2018

Reaction RXN66-480

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phytenoyl-CoA synthetase
    • long-chain-fatty-acid-CoA ligase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 coenzyme A[c] + 1 phytenate[c] => 1 AMP[c] + 1 diphosphate[c] + 1 phytenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-389, phytol degradation: PWY66-389
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN66-480&oldid=18892"