Difference between revisions of "TYR"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphorylated-pyruvate-dehydrogenases Phosphorylated-pyruvate-dehydrogenases] == * common name...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == |
+ | * smiles: | ||
+ | ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=OUYCCCASQSFEME-QMMMGPOBSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-tyrosine |
+ | * molecular weight: | ||
+ | ** 181.191 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Y |
+ | ** tyr | ||
+ | ** tyrosine | ||
+ | ** L-tyr | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-5861]] | ||
+ | * [[MONOPHENOL-MONOOXYGENASE-RXN]] | ||
+ | * [[biomass_rxn]] | ||
+ | * [[TYROSINE--TRNA-LIGASE-RXN]] | ||
+ | * [[TRANS-RXN1HP7-10]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TRANS-RXN1HP7-10]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[TYROSINE-AMINOTRANSFERASE-RXN]] |
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 60-18-4 |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC58315 |
− | {{#set: consumed | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6942100 6942100] | ||
+ | * HMDB : HMDB00158 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00082 C00082] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58315 58315] | ||
+ | * BIGG : tyr__L | ||
+ | {{#set: smiles=C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=OUYCCCASQSFEME-QMMMGPOBSA-N}} | ||
+ | {{#set: common name=L-tyrosine}} | ||
+ | {{#set: molecular weight=181.191 }} | ||
+ | {{#set: common name=Y|tyr|tyrosine|L-tyr}} | ||
+ | {{#set: consumed by=RXN-5861|MONOPHENOL-MONOOXYGENASE-RXN|biomass_rxn|TYROSINE--TRNA-LIGASE-RXN|TRANS-RXN1HP7-10}} | ||
+ | {{#set: produced by=TRANS-RXN1HP7-10}} | ||
+ | {{#set: reversible reaction associated=TYROSINE-AMINOTRANSFERASE-RXN}} |
Revision as of 17:02, 23 May 2018
Contents
Metabolite TYR
- smiles:
- C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-]
- inchi key:
- InChIKey=OUYCCCASQSFEME-QMMMGPOBSA-N
- common name:
- L-tyrosine
- molecular weight:
- 181.191
- Synonym(s):
- Y
- tyr
- tyrosine
- L-tyr
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 60-18-4
- METABOLIGHTS : MTBLC58315
- PUBCHEM:
- HMDB : HMDB00158
- LIGAND-CPD:
- CHEBI:
- BIGG : tyr__L
"C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-" cannot be used as a page name in this wiki.