Difference between revisions of "RXN-10974"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-5ALPHA-CHOLEST-7-EN-3BET 44-DIMETHYL-5ALPHA-CHOLEST-7-EN-3BET] == * smiles: ** CC(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10974 RXN-10974] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-5ALPHA-CHOLEST-7-EN-3BET 44-DIMETHYL-5ALPHA-CHOLEST-7-EN-3BET] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10974 RXN-10974] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(C)(C)C(CCC(C)12)O))3))4))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=UVNXFLZMQCAWCP-RCTKLBHESA-N
+
** [http://enzyme.expasy.org/EC/2.7.4.21 EC-2.7.4.21]
−
* common name:
+
** [http://enzyme.expasy.org/EC/2.7.4.24 EC-2.7.4.24]
−
** 4,4-dimethyl-5α-cholest-7-en-3β-ol
+
−
* molecular weight:
+
−
** 414.713   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[1.14.13.72-RXN]]
+
* With identifiers:
−
* [[RXN-13188]]
+
** 1 [[CPD-11700]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-11938]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 1D-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00003487001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6369]], inositol pyrophosphates biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369]
 +
** '''6''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460076 5460076]
+
{{#set: ec number=EC-2.7.4.21}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-2.7.4.24}}
−
** [http://www.chemspider.com/Chemical-Structure.4573747.html 4573747]
+
{{#set: gene associated=CHC_T00003487001_1}}
−
* CHEBI:
+
{{#set: in pathway=PWY-6369}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16455 16455]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04530 C04530]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(C)(C)C(CCC(C)12)O))3))4))}}
+
−
{{#set: inchi key=InChIKey=UVNXFLZMQCAWCP-RCTKLBHESA-N}}
+
−
{{#set: common name=4,4-dimethyl-5α-cholest-7-en-3β-ol}}
+
−
{{#set: molecular weight=414.713    }}
+
−
{{#set: consumed by=1.14.13.72-RXN|RXN-13188}}
+

Latest revision as of 17:02, 23 May 2018

Reaction RXN-10974

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 1D-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate[c] + 1 ATP[c] => 1 ADP[c] + 1 1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6369, inositol pyrophosphates biosynthesis: PWY-6369
    • 6 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-10974&oldid=18914"