Difference between revisions of "RXN66-23"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11939 CPD-11939] == * smiles: ** C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])OP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-23 RXN66-23] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11939 CPD-11939] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-23 RXN66-23] ==
* smiles:
+
* direction:
** C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP([O-])(=O)[O-])C(OP([O-])([O-])=O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=HHQOOERQSFJGEP-ZSIQDKGESA-A
+
** [http://enzyme.expasy.org/EC/1.1.1.170 EC-1.1.1.170]
* common name:
+
** 3,5-bisdiphosphoinositol-1D-myo-inositol 2,3,4,6-tetrakisphosphate
+
* molecular weight:
+
** 805.885   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-10973]]
+
** 1 [[CPD-8619]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CPD-8620]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 4α-carboxy-5α-cholesta-8-en-3β-ol[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 NAD(P)H[c] '''+''' 1 5α-cholesta-8-en-3-one[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00003646001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
 +
** '''15''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479423 45479423]
+
{{#set: ec number=EC-1.1.1.170}}
{{#set: smiles=C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP([O-])(=O)[O-])C(OP([O-])([O-])=O)1)}}
+
{{#set: gene associated=CHC_T00003646001_1}}
{{#set: inchi key=InChIKey=HHQOOERQSFJGEP-ZSIQDKGESA-A}}
+
{{#set: in pathway=PWY66-3}}
{{#set: common name=3,5-bisdiphosphoinositol-1D-myo-inositol 2,3,4,6-tetrakisphosphate}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=805.885    }}
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
{{#set: produced by=RXN-10973}}
+
{{#set: reconstruction tool=pantograph}}

Revision as of 18:02, 23 May 2018

Reaction RXN66-23

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-3, cholesterol biosynthesis II (via 24,25-dihydrolanosterol): PWY66-3
    • 15 reactions found over 22 reactions in the full pathway

Reconstruction information

External links