Difference between revisions of "CPD0-1065"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(CC[N+]CCCCC[N+])[N+] | ** C(CC[N+]CCCCC[N+])[N+] | ||
| + | * molecular weight: | ||
| + | ** 162.298 | ||
* inchi key: | * inchi key: | ||
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q | ** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q | ||
* common name: | * common name: | ||
** aminopropylcadaverine | ** aminopropylcadaverine | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** N-3-aminopropyl-1,5-diaminopentane | ** N-3-aminopropyl-1,5-diaminopentane | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565] | ** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565] | ||
* HMDB : HMDB12189 | * HMDB : HMDB12189 | ||
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}} | {{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}} | ||
| + | {{#set: molecular weight=162.298 }} | ||
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}} | {{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}} | ||
{{#set: common name=aminopropylcadaverine}} | {{#set: common name=aminopropylcadaverine}} | ||
| − | |||
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}} | {{#set: common name=N-3-aminopropyl-1,5-diaminopentane}} | ||
{{#set: produced by=RXN0-5217}} | {{#set: produced by=RXN0-5217}} | ||
Latest revision as of 15:01, 9 January 2019
Contents
Metabolite CPD0-1065
- smiles:
- C(CC[N+]CCCCC[N+])[N+]
- molecular weight:
- 162.298
- inchi key:
- InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
- common name:
- aminopropylcadaverine
- Synonym(s):
- N-3-aminopropyl-1,5-diaminopentane
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC[N+]CCCCC[N+])[N+" cannot be used as a page name in this wiki.
