Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP(=O)([O-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1) | ** C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1) | ||
| + | * molecular weight: | ||
| + | ** 414.049 | ||
* inchi key: | * inchi key: | ||
** InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H | ** InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H | ||
* common name: | * common name: | ||
** D-myo-inositol (1,3,4)-trisphosphate | ** D-myo-inositol (1,3,4)-trisphosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** Ins(1,3,4)P3 | ** Ins(1,3,4)P3 | ||
| Line 16: | Line 16: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[2.7.1.139-RXN]] | * [[2.7.1.139-RXN]] | ||
| − | |||
* [[2.7.1.133-RXN]] | * [[2.7.1.133-RXN]] | ||
| + | * [[RXN-10939]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-8730]] | * [[RXN-8730]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58414 58414] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58414 58414] | ||
| Line 29: | Line 27: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201948 25201948] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201948 25201948] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01243 C01243] | ||
* HMDB : HMDB01143 | * HMDB : HMDB01143 | ||
{{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}} | {{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}} | ||
| + | {{#set: molecular weight=414.049 }} | ||
{{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H}} | {{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H}} | ||
{{#set: common name=D-myo-inositol (1,3,4)-trisphosphate}} | {{#set: common name=D-myo-inositol (1,3,4)-trisphosphate}} | ||
| − | |||
{{#set: common name=Ins(1,3,4)P3|1-D-myo-inositol (1,3,4)-trisphosphate|inositol 1,3,4-trisphosphate}} | {{#set: common name=Ins(1,3,4)P3|1-D-myo-inositol (1,3,4)-trisphosphate|inositol 1,3,4-trisphosphate}} | ||
| − | {{#set: consumed by=2.7.1.139-RXN | + | {{#set: consumed by=2.7.1.139-RXN|2.7.1.133-RXN|RXN-10939}} |
{{#set: produced by=RXN-8730}} | {{#set: produced by=RXN-8730}} | ||
Latest revision as of 15:28, 9 January 2019
Contents
Metabolite INOSITOL-1-3-4-TRIPHOSPHATE
- smiles:
- C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
- molecular weight:
- 414.049
- inchi key:
- InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H
- common name:
- D-myo-inositol (1,3,4)-trisphosphate
- Synonym(s):
- Ins(1,3,4)P3
- 1-D-myo-inositol (1,3,4)-trisphosphate
- inositol 1,3,4-trisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.
