Difference between revisions of "CPD-12935"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * smiles: ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1) | ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1) | ||
+ | * molecular weight: | ||
+ | ** 482.748 | ||
* inchi key: | * inchi key: | ||
** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N | ** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N | ||
* common name: | * common name: | ||
** 4'-apo-β-carotenal | ** 4'-apo-β-carotenal | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** β-apo-4'-carotenal | ** β-apo-4'-carotenal | ||
Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C19892 C19892] | ||
{{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}} | {{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}} | ||
+ | {{#set: molecular weight=482.748 }} | ||
{{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}} | {{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}} | ||
{{#set: common name=4'-apo-β-carotenal}} | {{#set: common name=4'-apo-β-carotenal}} | ||
− | |||
{{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}} | {{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}} | ||
{{#set: produced by=RXN-11989}} | {{#set: produced by=RXN-11989}} |
Latest revision as of 15:34, 9 January 2019
Contents
Metabolite CPD-12935
- smiles:
- CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
- molecular weight:
- 482.748
- inchi key:
- InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
- common name:
- 4'-apo-β-carotenal
- Synonym(s):
- β-apo-4'-carotenal
- 4'-apo-β,ψ-caroten-4'-al
- 4'-apo-β,ψ-carotenal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links