Difference between revisions of "CPD-15717"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15717 CPD-15717] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * inchi key:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O | ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O | ||
| + | * molecular weight: | ||
| + | ** 342.299 | ||
* inchi key: | * inchi key: | ||
** InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N | ** InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N | ||
* common name: | * common name: | ||
** β-maltose | ** β-maltose | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** α-D-glucopyranose-(1→4)-β-D-glucopyranose | ** α-D-glucopyranose-(1→4)-β-D-glucopyranose | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[RXN-1827]] | * [[RXN-1827]] | ||
| + | * [[RXN-15909]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18147 18147] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18147 18147] | ||
| Line 25: | Line 23: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6255 6255] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6255 6255] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01971 C01971] | ||
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O}} | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O}} | ||
| + | {{#set: molecular weight=342.299 }} | ||
{{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N}} | {{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N}} | ||
{{#set: common name=β-maltose}} | {{#set: common name=β-maltose}} | ||
| − | |||
{{#set: common name=α-D-glucopyranose-(1→4)-β-D-glucopyranose}} | {{#set: common name=α-D-glucopyranose-(1→4)-β-D-glucopyranose}} | ||
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-1827|RXN-15909}} |
Latest revision as of 15:40, 9 January 2019
Contents
Metabolite CPD-15717
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O
- molecular weight:
- 342.299
- inchi key:
- InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N
- common name:
- β-maltose
- Synonym(s):
- α-D-glucopyranose-(1→4)-β-D-glucopyranose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
