Difference between revisions of "CHLOROPHYLLIDE-A"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 612.967 | ** 612.967 | ||
+ | * common name: | ||
+ | ** chlorophyllide a | ||
* Synonym(s): | * Synonym(s): | ||
** chlorophyllide | ** chlorophyllide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7676]] |
* [[RXN-17429]] | * [[RXN-17429]] | ||
* [[RXN-13398]] | * [[RXN-13398]] | ||
− | * [[RXN- | + | * [[RXN-7663]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-5286]] | * [[RXN-5286]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[RXN1F-66]] | * [[RXN1F-66]] | ||
+ | * [[RXN1F-10]] | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348] | ||
* CAS : 14897-06-4 | * CAS : 14897-06-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368] | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139] | ** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139] | ||
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
− | |||
{{#set: molecular weight=612.967 }} | {{#set: molecular weight=612.967 }} | ||
+ | {{#set: common name=chlorophyllide a}} | ||
{{#set: common name=chlorophyllide}} | {{#set: common name=chlorophyllide}} | ||
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-7676|RXN-17429|RXN-13398|RXN-7663}} |
{{#set: produced by=RXN-5286}} | {{#set: produced by=RXN-5286}} | ||
− | {{#set: reversible reaction associated=RXN1F- | + | {{#set: reversible reaction associated=RXN1F-66|RXN1F-10}} |
Latest revision as of 16:54, 9 January 2019
Contents
Metabolite CHLOROPHYLLIDE-A
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- molecular weight:
- 612.967
- common name:
- chlorophyllide a
- Synonym(s):
- chlorophyllide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.