Difference between revisions of "CPD-11712"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C * i...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C | ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C | ||
| + | * molecular weight: | ||
| + | ** 396.612 | ||
* inchi key: | * inchi key: | ||
** InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N | ** InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N | ||
* common name: | * common name: | ||
** 2-methyl-6-geranylgeranyl-1,4-benzoquinol | ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** MGGBQ | ** MGGBQ | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75411 75411] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75411 75411] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14759579 14759579] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14759579 14759579] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C20737 C20737] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10470958.html 10470958] | ||
{{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C}} | {{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C}} | ||
| + | {{#set: molecular weight=396.612 }} | ||
{{#set: inchi key=InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N}} | {{#set: inchi key=InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N}} | ||
{{#set: common name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}} | {{#set: common name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}} | ||
| − | |||
{{#set: common name=MGGBQ}} | {{#set: common name=MGGBQ}} | ||
{{#set: consumed by=RXN-14917}} | {{#set: consumed by=RXN-14917}} | ||
Latest revision as of 15:58, 9 January 2019
Contents
Metabolite CPD-11712
- smiles:
- CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C
- molecular weight:
- 396.612
- inchi key:
- InChIKey=DOWCCBNJUZOLRJ-MLAGYPMBSA-N
- common name:
- 2-methyl-6-geranylgeranyl-1,4-benzoquinol
- Synonym(s):
- MGGBQ
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
