Difference between revisions of "CPD-1789"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=ZZZCUOFIHG...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(C(O)=C(O)C(=O)O1) | ** C(O)C1(C(O)=C(O)C(=O)O1) | ||
| + | * molecular weight: | ||
| + | ** 146.099 | ||
* inchi key: | * inchi key: | ||
** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N | ** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N | ||
* common name: | * common name: | ||
** dehydro-D-arabinono-1,4-lactone | ** dehydro-D-arabinono-1,4-lactone | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one | ** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316] | ** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316] | ||
{{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}} | {{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}} | ||
| + | {{#set: molecular weight=146.099 }} | ||
{{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}} | {{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}} | ||
{{#set: common name=dehydro-D-arabinono-1,4-lactone}} | {{#set: common name=dehydro-D-arabinono-1,4-lactone}} | ||
| − | |||
{{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}} | {{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}} | ||
{{#set: produced by=1.1.3.37-RXN}} | {{#set: produced by=1.1.3.37-RXN}} | ||
Latest revision as of 16:12, 9 January 2019
Contents
Metabolite CPD-1789
- smiles:
- C(O)C1(C(O)=C(O)C(=O)O1)
- molecular weight:
- 146.099
- inchi key:
- InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
- common name:
- dehydro-D-arabinono-1,4-lactone
- Synonym(s):
- (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
- D-erythro-ascorbic acid
- D-erythro-ascorbate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
