Difference between revisions of "CPD-8613"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C | ||
+ | * molecular weight: | ||
+ | ** 443.688 | ||
* inchi key: | * inchi key: | ||
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M | ** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M | ||
* common name: | * common name: | ||
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol | ** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
Line 14: | Line 14: | ||
* [[RXN66-18]] | * [[RXN66-18]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN66-17]] | * [[RXN66-17]] | ||
+ | * [[RXN-13711]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592] | ||
* HMDB : HMDB12165 | * HMDB : HMDB12165 | ||
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}} | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}} | ||
+ | {{#set: molecular weight=443.688 }} | ||
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}} | {{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}} | ||
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}} | {{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}} | ||
− | |||
{{#set: consumed by=RXN66-18}} | {{#set: consumed by=RXN66-18}} | ||
− | {{#set: produced by= | + | {{#set: produced by=RXN66-17|RXN-13711}} |
Latest revision as of 17:15, 9 January 2019
Contents
Metabolite CPD-8613
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
- molecular weight:
- 443.688
- inchi key:
- InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
- common name:
- 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.