Difference between revisions of "CPD-10793"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == * smiles: ** [CH](=O)C(=O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=NZ...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** [CH](=O)C(=O)COP(=O)([O-])[O-] | ** [CH](=O)C(=O)COP(=O)([O-])[O-] | ||
| + | * molecular weight: | ||
| + | ** 166.027 | ||
* inchi key: | * inchi key: | ||
** InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L | ** InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
** hydroxypyruvaldehyde phosphate | ** hydroxypyruvaldehyde phosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** 2,3-dioxopropyl dihydrogen phosphate | ** 2,3-dioxopropyl dihydrogen phosphate | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58860 58860] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58860 58860] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21126161 21126161] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21126161 21126161] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16849 C16849] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19993665.html 19993665] | ||
{{#set: smiles=[CH](=O)C(=O)COP(=O)([O-])[O-]}} | {{#set: smiles=[CH](=O)C(=O)COP(=O)([O-])[O-]}} | ||
| + | {{#set: molecular weight=166.027 }} | ||
{{#set: inchi key=InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L}} | {{#set: inchi key=InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L}} | ||
{{#set: common name=hydroxypyruvaldehyde phosphate}} | {{#set: common name=hydroxypyruvaldehyde phosphate}} | ||
| − | |||
{{#set: common name=2,3-dioxopropyl dihydrogen phosphate}} | {{#set: common name=2,3-dioxopropyl dihydrogen phosphate}} | ||
{{#set: consumed by=RXN-17808}} | {{#set: consumed by=RXN-17808}} | ||
Latest revision as of 16:15, 9 January 2019
Contents
Metabolite CPD-10793
- smiles:
- [CH](=O)C(=O)COP(=O)([O-])[O-]
- molecular weight:
- 166.027
- inchi key:
- InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L
- common name:
- hydroxypyruvaldehyde phosphate
- Synonym(s):
- 2,3-dioxopropyl dihydrogen phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
