Difference between revisions of "CPD-12321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C | ||
+ | * molecular weight: | ||
+ | ** 544.946 | ||
* inchi key: | * inchi key: | ||
** InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N | ** InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N | ||
* common name: | * common name: | ||
** 15-cis-phytoene | ** 15-cis-phytoene | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
Line 15: | Line 15: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[RXN-12414]] | * [[RXN-12414]] | ||
+ | * [[RXN-13323]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27787 27787] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27787 27787] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9963391 9963391] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9963391 9963391] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05421 C05421] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.8138988.html 8138988] | ||
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C}} | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C}} | ||
+ | {{#set: molecular weight=544.946 }} | ||
{{#set: inchi key=InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N}} | {{#set: inchi key=InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N}} | ||
{{#set: common name=15-cis-phytoene}} | {{#set: common name=15-cis-phytoene}} | ||
− | |||
{{#set: consumed by=RXN-12243}} | {{#set: consumed by=RXN-12243}} | ||
− | {{#set: reversible reaction associated=RXN- | + | {{#set: reversible reaction associated=RXN-12414|RXN-13323}} |
Latest revision as of 18:05, 9 January 2019
Contents
Metabolite CPD-12321
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C
- molecular weight:
- 544.946
- inchi key:
- InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N
- common name:
- 15-cis-phytoene
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links