Difference between revisions of "CPD-2742"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) | ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) | ||
| + | * molecular weight: | ||
| + | ** 176.218 | ||
* inchi key: | * inchi key: | ||
** InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N | ** InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N | ||
* common name: | * common name: | ||
** cotinine | ** cotinine | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[RXN66-169]] | * [[RXN66-169]] | ||
| − | |||
* [[RXN66-163]] | * [[RXN66-163]] | ||
| + | * [[RXN66-161]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68641 68641] | ||
| + | * METABOLIGHTS : MTBLC68641 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=854019 854019] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=854019 854019] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.746405.html 746405] | ** [http://www.chemspider.com/Chemical-Structure.746405.html 746405] | ||
| − | |||
| − | |||
| − | |||
* HMDB : HMDB01046 | * HMDB : HMDB01046 | ||
{{#set: smiles=C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))}} | {{#set: smiles=C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))}} | ||
| + | {{#set: molecular weight=176.218 }} | ||
{{#set: inchi key=InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N}} | {{#set: inchi key=InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N}} | ||
{{#set: common name=cotinine}} | {{#set: common name=cotinine}} | ||
| − | + | {{#set: consumed by=RXN66-169|RXN66-163|RXN66-161}} | |
| − | {{#set: consumed by=RXN66-169|RXN66- | + | |
Latest revision as of 17:08, 9 January 2019
Contents
Metabolite CPD-2742
- smiles:
- C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))
- molecular weight:
- 176.218
- inchi key:
- InChIKey=UIKROCXWUNQSPJ-VIFPVBQESA-N
- common name:
- cotinine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.
