Difference between revisions of "CPD-17049"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) | ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) | ||
| + | * molecular weight: | ||
| + | ** 298.374 | ||
* inchi key: | * inchi key: | ||
** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N | ** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N | ||
* common name: | * common name: | ||
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP | ||
| Line 24: | Line 24: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023] | ||
{{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}} | {{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}} | ||
| + | {{#set: molecular weight=298.374 }} | ||
{{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}} | {{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}} | ||
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}} | {{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}} | ||
| − | |||
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}} | {{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}} | ||
{{#set: consumed by=RXN-15684}} | {{#set: consumed by=RXN-15684}} | ||
Latest revision as of 17:12, 9 January 2019
Contents
Metabolite CPD-17049
- smiles:
- C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
- molecular weight:
- 298.374
- inchi key:
- InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
- common name:
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
- Synonym(s):
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
