Difference between revisions of "CPD-1302"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == * smiles: ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3)) | ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3)) | ||
| + | * molecular weight: | ||
| + | ** 713.66 | ||
* inchi key: | * inchi key: | ||
** InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J | ** InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J | ||
* common name: | * common name: | ||
** N5-methyl--tetrahydropteroyl tri-L-glutamate | ** N5-methyl--tetrahydropteroyl tri-L-glutamate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** N5-methyl--H4PteGlu3 | ** N5-methyl--H4PteGlu3 | ||
| Line 19: | Line 19: | ||
* [[HOMOCYSMET-RXN]] | * [[HOMOCYSMET-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58207 58207] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58207 58207] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852302 49852302] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04489 C04489] | ** [http://www.genome.jp/dbget-bin/www_bget?C04489 C04489] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.17625689.html 17625689] | ||
* HMDB : HMDB12177 | * HMDB : HMDB12177 | ||
{{#set: smiles=CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))}} | {{#set: smiles=CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))}} | ||
| + | {{#set: molecular weight=713.66 }} | ||
{{#set: inchi key=InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J}} | {{#set: inchi key=InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J}} | ||
{{#set: common name=N5-methyl--tetrahydropteroyl tri-L-glutamate}} | {{#set: common name=N5-methyl--tetrahydropteroyl tri-L-glutamate}} | ||
| − | |||
{{#set: common name=N5-methyl--H4PteGlu3|5-methyltetrahydropteroyl tri-L-glutamate}} | {{#set: common name=N5-methyl--H4PteGlu3|5-methyltetrahydropteroyl tri-L-glutamate}} | ||
{{#set: consumed by=RXN-12730}} | {{#set: consumed by=RXN-12730}} | ||
{{#set: reversible reaction associated=HOMOCYSMET-RXN}} | {{#set: reversible reaction associated=HOMOCYSMET-RXN}} | ||
Latest revision as of 17:17, 9 January 2019
Contents
Metabolite CPD-1302
- smiles:
- CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))
- molecular weight:
- 713.66
- inchi key:
- InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J
- common name:
- N5-methyl--tetrahydropteroyl tri-L-glutamate
- Synonym(s):
- N5-methyl--H4PteGlu3
- 5-methyltetrahydropteroyl tri-L-glutamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))" cannot be used as a page name in this wiki.
