Difference between revisions of "FMNH2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] == * smiles: ** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3))) | ** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3))) | ||
| + | * molecular weight: | ||
| + | ** 456.348 | ||
* inchi key: | * inchi key: | ||
** InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L | ** InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L | ||
* common name: | * common name: | ||
** FMNH2 | ** FMNH2 | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** Reduced FMN | ** Reduced FMN | ||
| Line 18: | Line 18: | ||
* [[RXN-9510]] | * [[RXN-9510]] | ||
== External links == | == External links == | ||
| + | * BIGG : fmnh2 | ||
* CAS : 5666-16-0 | * CAS : 5666-16-0 | ||
| − | |||
| − | |||
* HMDB : HMDB01142 | * HMDB : HMDB01142 | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57618 57618] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57618 57618] | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01847 C01847] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229161 44229161] | ||
{{#set: smiles=CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))}} | {{#set: smiles=CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))}} | ||
| + | {{#set: molecular weight=456.348 }} | ||
{{#set: inchi key=InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L}} | {{#set: inchi key=InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L}} | ||
{{#set: common name=FMNH2}} | {{#set: common name=FMNH2}} | ||
| − | |||
{{#set: common name=Reduced FMN|reduced flavin mononucleotide}} | {{#set: common name=Reduced FMN|reduced flavin mononucleotide}} | ||
{{#set: reversible reaction associated=RXN-9510}} | {{#set: reversible reaction associated=RXN-9510}} | ||
Latest revision as of 17:20, 9 January 2019
Contents
Metabolite FMNH2
- smiles:
- CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))
- molecular weight:
- 456.348
- inchi key:
- InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L
- common name:
- FMNH2
- Synonym(s):
- Reduced FMN
- reduced flavin mononucleotide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))" cannot be used as a page name in this wiki.
