Difference between revisions of "CPD-6993"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) | ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) | ||
| + | * molecular weight: | ||
| + | ** 256.257 | ||
* inchi key: | * inchi key: | ||
** InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N | ** InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N | ||
* common name: | * common name: | ||
** pinocembrin chalcone | ** pinocembrin chalcone | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80484 80484] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80484 80484] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6474295 6474295] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16404 C16404] | ** [http://www.genome.jp/dbget-bin/www_bget?C16404 C16404] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4976321.html 4976321] | ||
{{#set: smiles=C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)}} | {{#set: smiles=C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)}} | ||
| + | {{#set: molecular weight=256.257 }} | ||
{{#set: inchi key=InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N}} | {{#set: inchi key=InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N}} | ||
{{#set: common name=pinocembrin chalcone}} | {{#set: common name=pinocembrin chalcone}} | ||
| − | |||
{{#set: consumed by=RXN-7647}} | {{#set: consumed by=RXN-7647}} | ||
{{#set: produced by=RXN-7645}} | {{#set: produced by=RXN-7645}} | ||
Latest revision as of 17:21, 9 January 2019
Contents
Metabolite CPD-6993
- smiles:
- C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)
- molecular weight:
- 256.257
- inchi key:
- InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N
- common name:
- pinocembrin chalcone
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
