Difference between revisions of "CPD-18761"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(=CC(=CCCO)C=CC(=O)1) | ** COC1(=CC(=CCCO)C=CC(=O)1) | ||
| + | * molecular weight: | ||
| + | ** 179.195 | ||
* inchi key: | * inchi key: | ||
** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N | ** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
** coniferyl alcohol radical | ** coniferyl alcohol radical | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 17: | Line 17: | ||
== External links == | == External links == | ||
{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}} | {{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}} | ||
| + | {{#set: molecular weight=179.195 }} | ||
{{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}} | {{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}} | ||
{{#set: common name=coniferyl alcohol radical}} | {{#set: common name=coniferyl alcohol radical}} | ||
| − | |||
{{#set: produced by=RXN-17352}} | {{#set: produced by=RXN-17352}} | ||
Latest revision as of 17:37, 9 January 2019
Contents
Metabolite CPD-18761
- smiles:
- COC1(=CC(=CCCO)C=CC(=O)1)
- molecular weight:
- 179.195
- inchi key:
- InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
- common name:
- coniferyl alcohol radical
- Synonym(s):
