Difference between revisions of "CPD-13375"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O) | ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O) | ||
| + | * molecular weight: | ||
| + | ** 1062.931 | ||
* inchi key: | * inchi key: | ||
** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N | ** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N | ||
* common name: | * common name: | ||
** XXXG xyloglucan oligosaccharide | ** XXXG xyloglucan oligosaccharide | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
* [[RXN-12398]] | * [[RXN-12398]] | ||
| + | * [[RXN-12399]] | ||
| + | * [[RXN-12400]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| Line 21: | Line 21: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180] | ||
{{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}} | {{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}} | ||
| + | {{#set: molecular weight=1062.931 }} | ||
{{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}} | {{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}} | ||
{{#set: common name=XXXG xyloglucan oligosaccharide}} | {{#set: common name=XXXG xyloglucan oligosaccharide}} | ||
| − | + | {{#set: produced by=RXN-12398|RXN-12399|RXN-12400}} | |
| − | {{#set: produced by=RXN- | + | |
Latest revision as of 17:39, 9 January 2019
Contents
Metabolite CPD-13375
- smiles:
- C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
- molecular weight:
- 1062.931
- inchi key:
- InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
- common name:
- XXXG xyloglucan oligosaccharide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
