Difference between revisions of "CPD-14780"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14780 CPD-14780] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey=PHOQVHQ...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(OC(C(C(C1O)O)O)=O) | ** C(O)C1(OC(C(C(C1O)O)O)=O) | ||
| + | * molecular weight: | ||
| + | ** 178.141 | ||
* inchi key: | * inchi key: | ||
** InChIKey=PHOQVHQSTUBQQK-MBMOQRBOSA-N | ** InChIKey=PHOQVHQSTUBQQK-MBMOQRBOSA-N | ||
* common name: | * common name: | ||
** D-mannono-1,5-lactone | ** D-mannono-1,5-lactone | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** D-mannonic acid δ-lactone | ** D-mannonic acid δ-lactone | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151504 151504] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151504 151504] | ||
| + | * DRUGBANK : DB01885 | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.133528.html 133528] | ** [http://www.chemspider.com/Chemical-Structure.133528.html 133528] | ||
{{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}} | {{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}} | ||
| + | {{#set: molecular weight=178.141 }} | ||
{{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-MBMOQRBOSA-N}} | {{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-MBMOQRBOSA-N}} | ||
{{#set: common name=D-mannono-1,5-lactone}} | {{#set: common name=D-mannono-1,5-lactone}} | ||
| − | |||
{{#set: common name=D-mannonic acid δ-lactone|(3S,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one|mannono-δ-lactone}} | {{#set: common name=D-mannonic acid δ-lactone|(3S,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one|mannono-δ-lactone}} | ||
{{#set: produced by=RXN-13741}} | {{#set: produced by=RXN-13741}} | ||
Latest revision as of 17:43, 9 January 2019
Contents
Metabolite CPD-14780
- smiles:
- C(O)C1(OC(C(C(C1O)O)O)=O)
- molecular weight:
- 178.141
- inchi key:
- InChIKey=PHOQVHQSTUBQQK-MBMOQRBOSA-N
- common name:
- D-mannono-1,5-lactone
- Synonym(s):
- D-mannonic acid δ-lactone
- (3S,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one
- mannono-δ-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
