Difference between revisions of "DETHIOBIOTIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(NC(=O)NC1CCCCCC(=O)[O-]) | ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) | ||
| + | * molecular weight: | ||
| + | ** 213.256 | ||
* inchi key: | * inchi key: | ||
** InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M | ** InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
** dethiobiotin | ** dethiobiotin | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** desthiobiotin | ** desthiobiotin | ||
| Line 20: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * BIGG : dtbt | ||
* CAS : 533-48-2 | * CAS : 533-48-2 | ||
| − | |||
| − | |||
* HMDB : HMDB03581 | * HMDB : HMDB03581 | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57861 57861] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57861 57861] | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01909 C01909] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244917 25244917] | ||
{{#set: smiles=CC1(NC(=O)NC1CCCCCC(=O)[O-])}} | {{#set: smiles=CC1(NC(=O)NC1CCCCCC(=O)[O-])}} | ||
| + | {{#set: molecular weight=213.256 }} | ||
{{#set: inchi key=InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M}} | {{#set: inchi key=InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M}} | ||
{{#set: common name=dethiobiotin}} | {{#set: common name=dethiobiotin}} | ||
| − | |||
{{#set: common name=desthiobiotin|DTB}} | {{#set: common name=desthiobiotin|DTB}} | ||
{{#set: consumed by=2.8.1.6-RXN|RXN-17472}} | {{#set: consumed by=2.8.1.6-RXN|RXN-17472}} | ||
{{#set: produced by=DETHIOBIOTIN-SYN-RXN}} | {{#set: produced by=DETHIOBIOTIN-SYN-RXN}} | ||
Latest revision as of 17:44, 9 January 2019
Contents
Metabolite DETHIOBIOTIN
- smiles:
- CC1(NC(=O)NC1CCCCCC(=O)[O-])
- molecular weight:
- 213.256
- inchi key:
- InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M
- common name:
- dethiobiotin
- Synonym(s):
- desthiobiotin
- DTB
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(NC(=O)NC1CCCCCC(=O)[O-])" cannot be used as a page name in this wiki.
