Difference between revisions of "QUEUINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) | ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) | ||
| + | * molecular weight: | ||
| + | ** 278.29 | ||
* inchi key: | * inchi key: | ||
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O | ** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O | ||
* common name: | * common name: | ||
** queuine | ** queuine | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine | ** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine | ||
| Line 18: | Line 18: | ||
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319] | ||
* HMDB : HMDB01495 | * HMDB : HMDB01495 | ||
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}} | {{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}} | ||
| + | {{#set: molecular weight=278.29 }} | ||
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}} | {{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}} | ||
{{#set: common name=queuine}} | {{#set: common name=queuine}} | ||
| − | |||
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}} | {{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}} | ||
{{#set: reversible reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}} | {{#set: reversible reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}} | ||
Latest revision as of 17:53, 9 January 2019
Contents
Metabolite QUEUINE
- smiles:
- C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
- molecular weight:
- 278.29
- inchi key:
- InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
- common name:
- queuine
- Synonym(s):
- 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
- base Q
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))" cannot be used as a page name in this wiki.
