Difference between revisions of "CPD-12481"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) | ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) | ||
+ | * molecular weight: | ||
+ | ** 182.138 | ||
* inchi key: | * inchi key: | ||
** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N | ** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
** 7-methylurate | ** 7-methylurate | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** 7-methyluric acid | ** 7-methyluric acid | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355] | ** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.62375.html 62375] | ||
* HMDB : HMDB11107 | * HMDB : HMDB11107 | ||
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}} | {{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}} | ||
+ | {{#set: molecular weight=182.138 }} | ||
{{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}} | {{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}} | ||
{{#set: common name=7-methylurate}} | {{#set: common name=7-methylurate}} | ||
− | |||
{{#set: common name=7-methyluric acid}} | {{#set: common name=7-methyluric acid}} | ||
{{#set: produced by=RXN-11521}} | {{#set: produced by=RXN-11521}} |
Latest revision as of 18:11, 9 January 2019
Contents
Metabolite CPD-12481
- smiles:
- CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
- molecular weight:
- 182.138
- inchi key:
- InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
- common name:
- 7-methylurate
- Synonym(s):
- 7-methyluric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links