Difference between revisions of "D-RIBULOSE-15-P2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == * smiles: ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-]...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-] | ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-] | ||
+ | * molecular weight: | ||
+ | ** 306.059 | ||
* inchi key: | * inchi key: | ||
** InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J | ** InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J | ||
* common name: | * common name: | ||
** D-ribulose-1,5-bisphosphate | ** D-ribulose-1,5-bisphosphate | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** ribulose 1,5-bisphosphate | ** ribulose 1,5-bisphosphate | ||
Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] | * [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] | ||
+ | * [[RXN-961]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[PHOSPHORIBULOKINASE-RXN]] | * [[PHOSPHORIBULOKINASE-RXN]] | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57870 57870] | ||
* CAS : 14689-84-0 | * CAS : 14689-84-0 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615473 23615473] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615473 23615473] | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01182 C01182] | ** [http://www.genome.jp/dbget-bin/www_bget?C01182 C01182] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3541504.html 3541504] | ||
{{#set: smiles=C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]}} | {{#set: smiles=C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]}} | ||
+ | {{#set: molecular weight=306.059 }} | ||
{{#set: inchi key=InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J}} | {{#set: inchi key=InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J}} | ||
{{#set: common name=D-ribulose-1,5-bisphosphate}} | {{#set: common name=D-ribulose-1,5-bisphosphate}} | ||
− | |||
{{#set: common name=ribulose 1,5-bisphosphate|D-ribulose-1,5-diphosphate|D-ribulose-1,5-P2}} | {{#set: common name=ribulose 1,5-bisphosphate|D-ribulose-1,5-diphosphate|D-ribulose-1,5-P2}} | ||
− | {{#set: consumed by= | + | {{#set: consumed by=RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN|RXN-961}} |
{{#set: reversible reaction associated=PHOSPHORIBULOKINASE-RXN}} | {{#set: reversible reaction associated=PHOSPHORIBULOKINASE-RXN}} |
Latest revision as of 18:11, 9 January 2019
Contents
Metabolite D-RIBULOSE-15-P2
- smiles:
- C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
- molecular weight:
- 306.059
- inchi key:
- InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
- common name:
- D-ribulose-1,5-bisphosphate
- Synonym(s):
- ribulose 1,5-bisphosphate
- D-ribulose-1,5-diphosphate
- D-ribulose-1,5-P2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.