Difference between revisions of "CPD-15834"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C | ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C | ||
| + | * molecular weight: | ||
| + | ** 410.639 | ||
* inchi key: | * inchi key: | ||
** InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N | ** InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N | ||
* common name: | * common name: | ||
** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol | ** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75412 75412] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75412 75412] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327035 5327035] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327035 5327035] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C20738 C20738] | ||
{{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C}} | {{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C}} | ||
| + | {{#set: molecular weight=410.639 }} | ||
{{#set: inchi key=InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N}} | {{#set: inchi key=InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N}} | ||
{{#set: common name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}} | {{#set: common name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}} | ||
| − | |||
{{#set: produced by=RXN-14917}} | {{#set: produced by=RXN-14917}} | ||
Latest revision as of 18:14, 9 January 2019
Contents
Metabolite CPD-15834
- smiles:
- CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C
- molecular weight:
- 410.639
- inchi key:
- InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N
- common name:
- 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
