Difference between revisions of "CPD-2750"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) | ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) | ||
| + | * molecular weight: | ||
| + | ** 192.217 | ||
* inchi key: | * inchi key: | ||
** InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N | ** InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N | ||
* common name: | * common name: | ||
** trans-3'-hydroxycotinine | ** trans-3'-hydroxycotinine | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71182 71182] | ||
| + | * METABOLIGHTS : MTBLC71182 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107963 107963] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107963 107963] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.97080.html 97080] | ** [http://www.chemspider.com/Chemical-Structure.97080.html 97080] | ||
| − | |||
| − | |||
| − | |||
* HMDB : HMDB01390 | * HMDB : HMDB01390 | ||
{{#set: smiles=C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))}} | {{#set: smiles=C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))}} | ||
| + | {{#set: molecular weight=192.217 }} | ||
{{#set: inchi key=InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N}} | {{#set: inchi key=InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N}} | ||
{{#set: common name=trans-3'-hydroxycotinine}} | {{#set: common name=trans-3'-hydroxycotinine}} | ||
| − | |||
{{#set: produced by=RXN66-161}} | {{#set: produced by=RXN66-161}} | ||
Latest revision as of 18:17, 9 January 2019
Contents
Metabolite CPD-2750
- smiles:
- C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))
- molecular weight:
- 192.217
- inchi key:
- InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N
- common name:
- trans-3'-hydroxycotinine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.
