Difference between revisions of "CPD-596"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] == * smiles: ** CN(C(=[N+])NCCCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDG...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CN(C(=[N+])NCCCC([N+])C(=O)[O-])C | ** CN(C(=[N+])NCCCC([N+])C(=O)[O-])C | ||
| + | * molecular weight: | ||
| + | ** 203.264 | ||
* inchi key: | * inchi key: | ||
** InChIKey=YDGMGEXADBMOMJ-LURJTMIESA-O | ** InChIKey=YDGMGEXADBMOMJ-LURJTMIESA-O | ||
* common name: | * common name: | ||
** N6,N6-dimethyl-L-arginine | ** N6,N6-dimethyl-L-arginine | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
* [[DIMETHYLARGININASE-RXN]] | * [[DIMETHYLARGININASE-RXN]] | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58326 58326] | ||
* CAS : 102783-24-4 | * CAS : 102783-24-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203330 25203330] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203330 25203330] | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03626 C03626] | ** [http://www.genome.jp/dbget-bin/www_bget?C03626 C03626] | ||
* HMDB : HMDB01539 | * HMDB : HMDB01539 | ||
{{#set: smiles=CN(C(=[N+])NCCCC([N+])C(=O)[O-])C}} | {{#set: smiles=CN(C(=[N+])NCCCC([N+])C(=O)[O-])C}} | ||
| + | {{#set: molecular weight=203.264 }} | ||
{{#set: inchi key=InChIKey=YDGMGEXADBMOMJ-LURJTMIESA-O}} | {{#set: inchi key=InChIKey=YDGMGEXADBMOMJ-LURJTMIESA-O}} | ||
{{#set: common name=N6,N6-dimethyl-L-arginine}} | {{#set: common name=N6,N6-dimethyl-L-arginine}} | ||
| − | |||
{{#set: reversible reaction associated=DIMETHYLARGININASE-RXN}} | {{#set: reversible reaction associated=DIMETHYLARGININASE-RXN}} | ||
Latest revision as of 18:19, 9 January 2019
Contents
Metabolite CPD-596
- smiles:
- CN(C(=[N+])NCCCC([N+])C(=O)[O-])C
- molecular weight:
- 203.264
- inchi key:
- InChIKey=YDGMGEXADBMOMJ-LURJTMIESA-O
- common name:
- N6,N6-dimethyl-L-arginine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CN(C(=[N+])NCCCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.
