Difference between revisions of "CPD1F-128"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * inch...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) | ||
| + | * molecular weight: | ||
| + | ** 272.473 | ||
* inchi key: | * inchi key: | ||
** InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N | ** InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N | ||
* common name: | * common name: | ||
** ent-kaurene | ** ent-kaurene | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** ent-kaur-16-ene | ** ent-kaur-16-ene | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15415 15415] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15415 15415] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966109 11966109] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C06090 C06090] | ** [http://www.genome.jp/dbget-bin/www_bget?C06090 C06090] | ||
| + | * LIPID_MAPS : LMPR0104130002 | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.16737395.html 16737395] | ||
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))}} | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))}} | ||
| + | {{#set: molecular weight=272.473 }} | ||
{{#set: inchi key=InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N}} | {{#set: inchi key=InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N}} | ||
{{#set: common name=ent-kaurene}} | {{#set: common name=ent-kaurene}} | ||
| − | |||
{{#set: common name=ent-kaur-16-ene}} | {{#set: common name=ent-kaur-16-ene}} | ||
{{#set: consumed by=1.14.13.78-RXN}} | {{#set: consumed by=1.14.13.78-RXN}} | ||
Latest revision as of 18:20, 9 January 2019
Contents
Metabolite CPD1F-128
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))
- molecular weight:
- 272.473
- inchi key:
- InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N
- common name:
- ent-kaurene
- Synonym(s):
- ent-kaur-16-ene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.
