Difference between revisions of "CPD-18779"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18779 CPD-18779] == * smiles: ** COC1(=C(O)CC(CO)(O)CC(=O)1) * common name: ** (S)-4-deoxyg...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(=C(O)CC(CO)(O)CC(=O)1) | ** COC1(=C(O)CC(CO)(O)CC(=O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 188.18 | ** 188.18 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZONRIYAALKITGT-QMMMGPOBSA-N | ||
| + | * common name: | ||
| + | ** (S)-4-deoxygadusol | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
== External links == | == External links == | ||
{{#set: smiles=COC1(=C(O)CC(CO)(O)CC(=O)1)}} | {{#set: smiles=COC1(=C(O)CC(CO)(O)CC(=O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=188.18 }} | {{#set: molecular weight=188.18 }} | ||
| + | {{#set: inchi key=InChIKey=ZONRIYAALKITGT-QMMMGPOBSA-N}} | ||
| + | {{#set: common name=(S)-4-deoxygadusol}} | ||
{{#set: consumed by=RXN-17368}} | {{#set: consumed by=RXN-17368}} | ||
{{#set: produced by=RXN-17896}} | {{#set: produced by=RXN-17896}} | ||
{{#set: reversible reaction associated=RXN-17370}} | {{#set: reversible reaction associated=RXN-17370}} | ||
Latest revision as of 18:20, 9 January 2019
Contents
Metabolite CPD-18779
- smiles:
- COC1(=C(O)CC(CO)(O)CC(=O)1)
- molecular weight:
- 188.18
- inchi key:
- InChIKey=ZONRIYAALKITGT-QMMMGPOBSA-N
- common name:
- (S)-4-deoxygadusol
- Synonym(s):
