Difference between revisions of "CPD-17319"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * inchi key: ** InChIKey=CILXJJLQPTUUSS-XQRV...")
 
(Created page with "Category:Gene == Gene CHC_T00007099001_1 == * Synonym(s): == Reactions associated == * RXN-15117 ** pantograph-a.taliana * RXN-5462 ** pantograph-ga...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] ==
+
== Gene CHC_T00007099001_1 ==
* smiles:
+
** CSCCC(C([O-])=CO)=O
+
* inchi key:
+
** InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
+
* common name:
+
** 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
+
* molecular weight:
+
** 161.195   
+
 
* Synonym(s):
 
* Synonym(s):
** 1,2-dihydroxy-3-keto-5-methylthiopentene anion
 
** 1,2-dihydroxy-3-keto-5-methylthiopentane
 
** 1,2-dihydroxy-3-keto-5-methylthiopentene
 
** acireductone
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[R147-RXN]]
+
* [[RXN-15117]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[a.taliana]]
* [[R83-RXN]]
+
* [[RXN-5462]]
* [[3.1.3.77-RXN]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
* [[RXN-5463]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways associated ==
 +
* [[PWY-7817]]
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-15117|RXN-5462|RXN-5463}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229177 44229177]
+
{{#set: pathway associated=PWY-7817|MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58795 58795]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15606 C15606]
+
* HMDB : HMDB12134
+
{{#set: smiles=CSCCC(C([O-])=CO)=O}}
+
{{#set: inchi key=InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M}}
+
{{#set: common name=1,2-dihydroxy-5-(methylthio)pent-1-en-3-one}}
+
{{#set: molecular weight=161.195    }}
+
{{#set: common name=1,2-dihydroxy-3-keto-5-methylthiopentene anion|1,2-dihydroxy-3-keto-5-methylthiopentane|1,2-dihydroxy-3-keto-5-methylthiopentene|acireductone}}
+
{{#set: consumed by=R147-RXN}}
+
{{#set: produced by=R83-RXN|3.1.3.77-RXN}}
+

Revision as of 10:46, 18 January 2018

Gene CHC_T00007099001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links