Difference between revisions of "PWY-7210"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxo-glutarate-dehydro-suc-DH-lipoyl Oxo-glutarate-dehydro-suc-DH-lipoyl] == * common name: ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == |
+ | * smiles: | ||
+ | ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O | ||
+ | * inchi key: | ||
+ | ** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-3-hydroxydecanoyl-CoA |
+ | * molecular weight: | ||
+ | ** 933.753 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12490]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13616]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616] | ||
+ | * BIGG : 3hdcoa | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629] | ||
+ | * HMDB : HMDB03938 | ||
+ | {{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}} | ||
+ | {{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}} | ||
+ | {{#set: common name=(S)-3-hydroxydecanoyl-CoA}} | ||
+ | {{#set: molecular weight=933.753 }} | ||
+ | {{#set: consumed by=RXN-12490}} | ||
+ | {{#set: produced by=RXN-13616}} |
Revision as of 11:46, 18 January 2018
Contents
Metabolite CPD0-2244
- smiles:
- CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
- inchi key:
- InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
- common name:
- (S)-3-hydroxydecanoyl-CoA
- molecular weight:
- 933.753
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.