Difference between revisions of "PWY-5469"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF 5-METHYL-THF] == * smiles: ** CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9527 RXN-9527] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-decanoyl-[acyl-carrier...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF 5-METHYL-THF] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9527 RXN-9527] ==
−
* smiles:
+
* direction:
−
** CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=3))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** N5-methyl-tetrahydropteroyl mono-L-glutamate
+
** 3-oxo-decanoyl-[acyl-carrier protein] synthase
−
* inchi key:
+
** Beta-ketoacyl synthase
−
** InChIKey=ZNOVTXRBGFNYRX-STQMWFEESA-L
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
−
** 457.445   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-methyl-tetrahydrofolate mono-L-glutamate
 
−
** 5-methyl-THF mono-L-glutamate
 
−
** 5-methyl-5,6,7,8-tetrahydrofolate mono-L-glutamate
 
−
** n5-methyltetrahydrofolate mono-L-glutamate
 
−
** N5-methyl-THF mono-L-glutamate
 
−
** methyl-THF mono-L-glutamate
 
−
** methyl-tetrahydrofolate mono-L-glutamate
 
−
** methyl-H4F mono-L-glutamate
 
−
** 5-methyl-5,6,7,8-tetrahydropteroyl-L-glutamate
 
−
** N5-methyl--H4PteGlu1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Octanoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[3-oxo-decanoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 an octanoyl-[acp][c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 a 3-oxo-decanoyl-[acp][c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00009465001_1]]
 +
** [[pantograph]]-[[a.taliana]]
 +
** [[pantograph]]-[[a.taliana]]
 +
* [[CHC_T00009465001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[a.taliana]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* CAS : 134-35-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 5mthf
+
{{#set: common name=3-oxo-decanoyl-[acyl-carrier protein] synthase}}
−
* PUBCHEM:
+
{{#set: common name=Beta-ketoacyl synthase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=42626431 42626431]
+
{{#set: ec number=EC-2.3.1.41}}
−
* HMDB : HMDB01396
+
{{#set: gene associated=CHC_T00009465001_1|CHC_T00009465001}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5971}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00440 C00440]
+
{{#set: reconstruction category=orthology}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.chemspider.com/Chemical-Structure.143.html 143]
+
{{#set: reconstruction source=a.taliana}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18608 18608]
+
{{#set: reconstruction tool=pathwaytools}}
−
* METABOLIGHTS : MTBLC18608
+
{{#set: reconstruction source=original_genome}}
−
{{#set: smiles=CN2([CH](CNC1(=C(C(=O)NC(N)=N1)2))CNC3(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=3))}}
+
−
{{#set: common name=N5-methyl-tetrahydropteroyl mono-L-glutamate}}
+
−
{{#set: inchi key=InChIKey=ZNOVTXRBGFNYRX-STQMWFEESA-L}}
+
−
{{#set: molecular weight=457.445    }}
+
−
{{#set: common name=5-methyl-tetrahydrofolate mono-L-glutamate|5-methyl-THF mono-L-glutamate|5-methyl-5,6,7,8-tetrahydrofolate mono-L-glutamate|n5-methyltetrahydrofolate mono-L-glutamate|N5-methyl-THF mono-L-glutamate|methyl-THF mono-L-glutamate|methyl-tetrahydrofolate mono-L-glutamate|methyl-H4F mono-L-glutamate|5-methyl-5,6,7,8-tetrahydropteroyl-L-glutamate|N5-methyl--H4PteGlu1}}
+
−
{{#set: consumed by=HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.}}
+
−
{{#set: produced by=1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.}}
+

Revision as of 10:46, 18 January 2018

Reaction RXN-9527

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-decanoyl-[acyl-carrier protein] synthase
    • Beta-ketoacyl synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxo-decanoyl-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.






Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-5469&oldid=4531"