Difference between revisions of "ISOVALERYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008878001_1 == * Synonym(s): == Reactions associated == * 1.1.1.39-RXN ** pantograph-galdieria.sulphuraria * MALIC-NADP-RXN *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * inchi key: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == |
| + | * smiles: | ||
| + | ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) | ||
| + | * inchi key: | ||
| + | ** InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** 7-methylxanthine | ||
| + | * molecular weight: | ||
| + | ** 166.139 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** heteroxanthine | ||
| + | ** 3,7-dihydro-7-methyl-1H-purine-2,6-dione | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11521]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68374 68374] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.61660.html 61660] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48991 48991] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16353 C16353] | ||
| + | * HMDB : HMDB01991 | ||
| + | {{#set: smiles=CN1(C=NC2(NC(=O)NC(=O)C1=2))}} | ||
| + | {{#set: inchi key=InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=7-methylxanthine}} | ||
| + | {{#set: molecular weight=166.139 }} | ||
| + | {{#set: common name=heteroxanthine|3,7-dihydro-7-methyl-1H-purine-2,6-dione}} | ||
| + | {{#set: consumed by=RXN-11521}} | ||
Revision as of 10:47, 18 January 2018
Contents
Metabolite 7-METHYLXANTHINE
- smiles:
- CN1(C=NC2(NC(=O)NC(=O)C1=2))
- inchi key:
- InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N
- common name:
- 7-methylxanthine
- molecular weight:
- 166.139
- Synonym(s):
- heteroxanthine
- 3,7-dihydro-7-methyl-1H-purine-2,6-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
