Difference between revisions of "CPD-9869"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
 
(Created page with "Category:Gene == Gene CHC_T00009277001 == * left end position: ** 443037 * transcription direction: ** NEGATIVE * right end position: ** 447555 * centisome position: ** 97...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Gene CHC_T00009277001 ==
* smiles:
+
* left end position:
** C(CC[N+]CCCCC[N+])[N+]
+
** 443037
* inchi key:
+
* transcription direction:
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
** NEGATIVE
* common name:
+
* right end position:
** aminopropylcadaverine
+
** 447555
* molecular weight:
+
* centisome position:
** 162.298    
+
** 97.23678    
 
* Synonym(s):
 
* Synonym(s):
** N-3-aminopropyl-1,5-diaminopentane
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[GLYCOGENSYN-RXN]]
* [[RXN0-5217]]
+
** original_genome
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-622]]
 +
* [[GLYCOGENSYNTH-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=443037}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: right end position=447555}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: centisome position=97.23678   }}
* LIGAND-CPD:
+
{{#set: reaction associated=GLYCOGENSYN-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
{{#set: pathway associated=PWY-622|GLYCOGENSYNTH-PWY}}
* HMDB : HMDB12189
+
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
{{#set: common name=aminopropylcadaverine}}
+
{{#set: molecular weight=162.298   }}
+
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
{{#set: produced by=RXN0-5217}}
+

Revision as of 10:47, 18 January 2018

Gene CHC_T00009277001

  • left end position:
    • 443037
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 447555
  • centisome position:
    • 97.23678
  • Synonym(s):

Reactions associated

Pathways associated

External links