Difference between revisions of "N-Acylated-Amino-Acids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18776 CPD-18776] == * smiles: ** COC1(C(=O)CC(CO)(O)CC(O)=1) * common name: ** (R)-4-deoxyg...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylated-Amino-Acids N-Acylated-Amino-Acids] == * common name: ** an N-acylated amino acid *...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18776 CPD-18776] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylated-Amino-Acids N-Acylated-Amino-Acids] ==
* smiles:
+
** COC1(C(=O)CC(CO)(O)CC(O)=1)
+
 
* common name:
 
* common name:
** (R)-4-deoxygadusol
+
** an N-acylated amino acid
* inchi key:
+
** InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N
+
* molecular weight:
+
** 188.18   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a N-acyl-amino acid
 +
** an N-acyl-L-amino acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17366]]
+
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-17370]]
 
 
== External links  ==
 
== External links  ==
{{#set: smiles=COC1(C(=O)CC(CO)(O)CC(O)=1)}}
+
{{#set: common name=an N-acylated amino acid}}
{{#set: common name=(R)-4-deoxygadusol}}
+
{{#set: common name=a N-acyl-amino acid|an N-acyl-L-amino acid}}
{{#set: inchi key=InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N}}
+
{{#set: produced by=ACYLAMINOACYL-PEPTIDASE-RXN}}
{{#set: molecular weight=188.18    }}
+
{{#set: produced by=RXN-17366}}
+
{{#set: consumed or produced by=RXN-17370}}
+

Revision as of 10:47, 18 January 2018

Metabolite N-Acylated-Amino-Acids

  • common name:
    • an N-acylated amino acid
  • Synonym(s):
    • a N-acyl-amino acid
    • an N-acyl-L-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links