Difference between revisions of "PWY-6681"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE-tRNAs PHE-tRNAs] == * common name: ** a tRNAphe * Synonym(s): ** TRNA(PHE) == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * smiles: ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == |
+ | * smiles: | ||
+ | ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 4-trans-3-oxo-undecenoyl-CoA |
+ | * molecular weight: | ||
+ | ** 943.749 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4E-3-oxo-undecenoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14793]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908] |
− | {{#set: | + | {{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
+ | {{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}} | ||
+ | {{#set: common name=4-trans-3-oxo-undecenoyl-CoA}} | ||
+ | {{#set: molecular weight=943.749 }} | ||
+ | {{#set: common name=4E-3-oxo-undecenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-14793}} |
Revision as of 10:47, 18 January 2018
Contents
Metabolite CPD-15678
- smiles:
- CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
- common name:
- 4-trans-3-oxo-undecenoyl-CoA
- molecular weight:
- 943.749
- Synonym(s):
- 4E-3-oxo-undecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.